CID 471161
Maribavir
Structural Information
- Molecular Formula
- C15H19Cl2N3O4
- SMILES
- CC(C)NC1=NC2=CC(=C(C=C2N1[C@@H]3[C@H]([C@H]([C@@H](O3)CO)O)O)Cl)Cl
- InChI
- InChI=1S/C15H19Cl2N3O4/c1-6(2)18-15-19-9-3-7(16)8(17)4-10(9)20(15)14-13(23)12(22)11(5-21)24-14/h3-4,6,11-14,21-23H,5H2,1-2H3,(H,18,19)/t11-,12-,13-,14-/m0/s1
- InChIKey
- KJFBVJALEQWJBS-XUXIUFHCSA-N
- Compound name
- (2S,3S,4R,5S)-2-[5,6-dichloro-2-(propan-2-ylamino)benzimidazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 376.08254 | 184.9 |
| [M+Na]+ | 398.06448 | 195.2 |
| [M-H]- | 374.06798 | 187.7 |
| [M+NH4]+ | 393.10908 | 197.6 |
| [M+K]+ | 414.03842 | 189.8 |
| [M+H-H2O]+ | 358.07252 | 179.8 |
| [M+HCOO]- | 420.07346 | 191.7 |
| [M+CH3COO]- | 434.08911 | 212.4 |
| [M+Na-2H]- | 396.04993 | 181.9 |
| [M]+ | 375.07471 | 189.8 |
| [M]- | 375.07581 | 189.8 |