CID 470488
Pyrimidine, 4,6-dichloro-2-[(phenylmethyl)thio]-
Structural Information
- Molecular Formula
- C11H8Cl2N2S
- SMILES
- C1=CC=C(C=C1)CSC2=NC(=CC(=N2)Cl)Cl
- InChI
- InChI=1S/C11H8Cl2N2S/c12-9-6-10(13)15-11(14-9)16-7-8-4-2-1-3-5-8/h1-6H,7H2
- InChIKey
- OSSXOGKDVQWILL-UHFFFAOYSA-N
- Compound name
- 2-benzylsulfanyl-4,6-dichloropyrimidine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 270.98580 | 150.7 |
| [M+Na]+ | 292.96774 | 161.7 |
| [M-H]- | 268.97124 | 154.5 |
| [M+NH4]+ | 288.01234 | 166.5 |
| [M+K]+ | 308.94168 | 154.8 |
| [M+H-H2O]+ | 252.97578 | 143.8 |
| [M+HCOO]- | 314.97672 | 158.5 |
| [M+CH3COO]- | 328.99237 | 162.8 |
| [M+Na-2H]- | 290.95319 | 154.6 |
| [M]+ | 269.97797 | 155.4 |
| [M]- | 269.97907 | 155.4 |