CID 4615423
P-cresol sulfate
Structural Information
- Molecular Formula
- C7H8O4S
- SMILES
- CC1=CC=C(C=C1)OS(=O)(=O)O
- InChI
- InChI=1S/C7H8O4S/c1-6-2-4-7(5-3-6)11-12(8,9)10/h2-5H,1H3,(H,8,9,10)
- InChIKey
- WGNAKZGUSRVWRH-UHFFFAOYSA-N
- Compound name
- (4-methylphenyl) hydrogen sulfate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 189.02161 | 134.4 |
| [M+Na]+ | 211.00355 | 143.8 |
| [M-H]- | 187.00705 | 137.6 |
| [M+NH4]+ | 206.04815 | 154.0 |
| [M+K]+ | 226.97749 | 141.6 |
| [M+H-H2O]+ | 171.01159 | 129.4 |
| [M+HCOO]- | 233.01253 | 152.5 |
| [M+CH3COO]- | 247.02818 | 174.5 |
| [M+Na-2H]- | 208.98900 | 140.0 |
| [M]+ | 188.01378 | 138.1 |
| [M]- | 188.01488 | 138.1 |