CID 458866
2,7-dibenzofurandiamine
Structural Information
- Molecular Formula
- C12H10N2O
- SMILES
- C1=CC2=C(C=C1N)OC3=C2C=C(C=C3)N
- InChI
- InChI=1S/C12H10N2O/c13-7-2-4-11-10(5-7)9-3-1-8(14)6-12(9)15-11/h1-6H,13-14H2
- InChIKey
- YCDUMXSNRLISHV-UHFFFAOYSA-N
- Compound name
- dibenzofuran-2,7-diamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 199.08660 | 138.4 |
| [M+Na]+ | 221.06854 | 149.6 |
| [M-H]- | 197.07204 | 145.0 |
| [M+NH4]+ | 216.11314 | 160.0 |
| [M+K]+ | 237.04248 | 146.1 |
| [M+H-H2O]+ | 181.07658 | 132.8 |
| [M+HCOO]- | 243.07752 | 164.0 |
| [M+CH3COO]- | 257.09317 | 153.2 |
| [M+Na-2H]- | 219.05399 | 147.2 |
| [M]+ | 198.07877 | 139.2 |
| [M]- | 198.07987 | 139.2 |