CID 457961
Nsc122420
Structural Information
- Molecular Formula
- C20H28O3
- SMILES
- CC(C)C1=CC2=CC(C3C(CCCC3(C2=C(C1=O)O)C)(C)C)O
- InChI
- InChI=1S/C20H28O3/c1-11(2)13-9-12-10-14(21)18-19(3,4)7-6-8-20(18,5)15(12)17(23)16(13)22/h9-11,14,18,21,23H,6-8H2,1-5H3
- InChIKey
- QEAIMIKGLGBTSA-UHFFFAOYSA-N
- Compound name
- 4,9-dihydroxy-4b,8,8-trimethyl-2-propan-2-yl-6,7,8a,9-tetrahydro-5H-phenanthren-3-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 317.21114 | 174.8 |
| [M+Na]+ | 339.19308 | 182.6 |
| [M-H]- | 315.19658 | 177.3 |
| [M+NH4]+ | 334.23768 | 194.8 |
| [M+K]+ | 355.16702 | 178.1 |
| [M+H-H2O]+ | 299.20112 | 169.7 |
| [M+HCOO]- | 361.20206 | 185.8 |
| [M+CH3COO]- | 375.21771 | 208.9 |
| [M+Na-2H]- | 337.17853 | 175.9 |
| [M]+ | 316.20331 | 172.8 |
| [M]- | 316.20441 | 172.8 |