CID 455167
(2s)-2-[[(2s)-5-(diaminomethylideneamino)-1-[[(2s)-1-[[(2s)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-phenylpropanoic acid
Structural Information
- Molecular Formula
- C30H43N7O6
- SMILES
- CC(C)[C@@H](C(=O)N[C@@H](CC1=CC=CC=C1)CO)NC(=O)[C@H](CCCN=C(N)N)NC(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O
- InChI
- InChI=1S/C30H43N7O6/c1-19(2)25(27(40)34-22(18-38)16-20-10-5-3-6-11-20)37-26(39)23(14-9-15-33-29(31)32)35-30(43)36-24(28(41)42)17-21-12-7-4-8-13-21/h3-8,10-13,19,22-25,38H,9,14-18H2,1-2H3,(H,34,40)(H,37,39)(H,41,42)(H4,31,32,33)(H2,35,36,43)/t22-,23-,24-,25-/m0/s1
- InChIKey
- FWFRRBPYKRBFLL-QORCZRPOSA-N
- Compound name
- (2S)-2-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-[[(2S)-1-hydroxy-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-phenylpropanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 598.33473 | 242.8 |
| [M+Na]+ | 620.31667 | 245.7 |
| [M-H]- | 596.32017 | 246.0 |
| [M+NH4]+ | 615.36127 | 224.7 |
| [M+K]+ | 636.29061 | 236.8 |
| [M+H-H2O]+ | 580.32471 | 231.2 |
| [M+HCOO]- | 642.32565 | 248.4 |
| [M+CH3COO]- | 656.34130 | 277.8 |
| [M+Na-2H]- | 618.30212 | 279.9 |
| [M]+ | 597.32690 | 284.4 |
| [M]- | 597.32800 | 284.4 |