CID 448994
(2r)-1-(dimethylamino)-3-{4-[(6-{[2-fluoro-5-(trifluoromethyl)phenyl]amino}pyrimidin-4-yl)amino]phenoxy}propan-2-ol
Structural Information
- Molecular Formula
- C22H23F4N5O2
- SMILES
- CN(C)C[C@H](COC1=CC=C(C=C1)NC2=CC(=NC=N2)NC3=C(C=CC(=C3)C(F)(F)F)F)O
- InChI
- InChI=1S/C22H23F4N5O2/c1-31(2)11-16(32)12-33-17-6-4-15(5-7-17)29-20-10-21(28-13-27-20)30-19-9-14(22(24,25)26)3-8-18(19)23/h3-10,13,16,32H,11-12H2,1-2H3,(H2,27,28,29,30)/t16-/m1/s1
- InChIKey
- OSCWQKTUILTARV-MRXNPFEDSA-N
- Compound name
- (2R)-1-(dimethylamino)-3-[4-[[6-[2-fluoro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]phenoxy]propan-2-ol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 466.18608 | 208.0 |
| [M+Na]+ | 488.16802 | 213.1 |
| [M-H]- | 464.17152 | 209.8 |
| [M+NH4]+ | 483.21262 | 212.1 |
| [M+K]+ | 504.14196 | 207.4 |
| [M+H-H2O]+ | 448.17606 | 192.7 |
| [M+HCOO]- | 510.17700 | 223.6 |
| [M+CH3COO]- | 524.19265 | 243.1 |
| [M+Na-2H]- | 486.15347 | 209.7 |
| [M]+ | 465.17825 | 204.4 |
| [M]- | 465.17935 | 204.4 |