CID 448812
Eptifibatide
Structural Information
- Molecular Formula
- C35H49N11O9S2
- SMILES
- C1C[C@H]2C(=O)N[C@@H](CSSCCC(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N2C1)CC3=CNC4=CC=CC=C43)CC(=O)O)CCCCN=C(N)N)C(=O)N
- InChI
- InChI=1S/C35H49N11O9S2/c36-30(51)25-18-57-56-13-10-27(47)42-22(8-3-4-11-39-35(37)38)31(52)41-17-28(48)43-23(15-29(49)50)32(53)44-24(14-19-16-40-21-7-2-1-6-20(19)21)34(55)46-12-5-9-26(46)33(54)45-25/h1-2,6-7,16,22-26,40H,3-5,8-15,17-18H2,(H2,36,51)(H,41,52)(H,42,47)(H,43,48)(H,44,53)(H,45,54)(H,49,50)(H4,37,38,39)/t22-,23-,24-,25-,26-/m0/s1
- InChIKey
- CZKPOZZJODAYPZ-LROMGURASA-N
- Compound name
- 2-[(3S,6S,12S,20R,23S)-20-carbamoyl-12-[4-(diaminomethylideneamino)butyl]-3-(1H-indol-3-ylmethyl)-2,5,8,11,14,22-hexaoxo-17,18-dithia-1,4,7,10,13,21-hexazabicyclo[21.3.0]hexacosan-6-yl]acetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 832.32288 | 265.2 |
| [M+Na]+ | 854.30482 | 270.1 |
| [M-H]- | 830.30832 | 254.6 |
| [M+NH4]+ | 849.34942 | 263.7 |
| [M+K]+ | 870.27876 | 259.0 |
| [M+H-H2O]+ | 814.31286 | 235.9 |
| [M+HCOO]- | 876.31380 | 264.4 |
| [M+CH3COO]- | 890.32945 | 267.2 |
| [M+Na-2H]- | 852.29027 | 266.0 |
| [M]+ | 831.31505 | 283.1 |
| [M]- | 831.31615 | 283.1 |