CID 44462758
2-[[(1r,2s)-2-aminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide
Structural Information
- Molecular Formula
- C19H23N9O
- SMILES
- C1CC[C@H]([C@H](C1)N)NC2=NC=C(C(=N2)NC3=CC(=CC=C3)N4N=CC=N4)C(=O)N
- InChI
- InChI=1S/C19H23N9O/c20-15-6-1-2-7-16(15)26-19-22-11-14(17(21)29)18(27-19)25-12-4-3-5-13(10-12)28-23-8-9-24-28/h3-5,8-11,15-16H,1-2,6-7,20H2,(H2,21,29)(H2,22,25,26,27)/t15-,16+/m0/s1
- InChIKey
- TXGKRVFSSHPBAJ-JKSUJKDBSA-N
- Compound name
- 2-[[(1R,2S)-2-aminocyclohexyl]amino]-4-[3-(triazol-2-yl)anilino]pyrimidine-5-carboxamide
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 394.20983 | 187.4 |
| [M+Na]+ | 416.19177 | 191.3 |
| [M-H]- | 392.19527 | 193.3 |
| [M+NH4]+ | 411.23637 | 191.1 |
| [M+K]+ | 432.16571 | 184.6 |
| [M+H-H2O]+ | 376.19981 | 174.2 |
| [M+HCOO]- | 438.20075 | 204.9 |
| [M+CH3COO]- | 452.21640 | 194.0 |
| [M+Na-2H]- | 414.17722 | 190.2 |
| [M]+ | 393.20200 | 179.9 |
| [M]- | 393.20310 | 179.9 |