CID 443323
3alpha,12alpha-dihydroxy-5beta-chol-6-en-24-oic acid
Structural Information
- Molecular Formula
- C24H38O4
- SMILES
- C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2C=C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C
- InChI
- InChI=1S/C24H38O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h5-6,14-21,25-26H,4,7-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1
- InChIKey
- LNOFKAWCANXKAC-LLQZFEROSA-N
- Compound name
- (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 391.28428 | 199.2 |
| [M+Na]+ | 413.26622 | 201.6 |
| [M-H]- | 389.26972 | 198.8 |
| [M+NH4]+ | 408.31082 | 217.2 |
| [M+K]+ | 429.24016 | 195.9 |
| [M+H-H2O]+ | 373.27426 | 194.4 |
| [M+HCOO]- | 435.27520 | 202.1 |
| [M+CH3COO]- | 449.29085 | 219.3 |
| [M+Na-2H]- | 411.25167 | 194.8 |
| [M]+ | 390.27645 | 192.2 |
| [M]- | 390.27755 | 192.2 |