CID 441838
Adonitoxin
Structural Information
- Molecular Formula
- C29H42O10
- SMILES
- C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(C[C@@H]([C@@H]5C6=CC(=O)OC6)O)O)C)C=O)O)O)O
- InChI
- InChI=1S/C29H42O10/c1-14-23(33)24(34)25(35)26(38-14)39-17-5-8-28(13-30)16(10-17)3-4-19-18(28)6-7-27(2)22(15-9-21(32)37-12-15)20(31)11-29(19,27)36/h9,13-14,16-20,22-26,31,33-36H,3-8,10-12H2,1-2H3/t14-,16+,17-,18-,19+,20-,22-,23-,24+,25+,26-,27+,28+,29-/m0/s1
- InChIKey
- ARANEVHRNOGYRH-BBNLJEPRSA-N
- Compound name
- (3S,5R,8R,9S,10R,13R,14S,16S,17R)-14,16-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 551.28508 | 225.6 |
| [M+Na]+ | 573.26702 | 227.5 |
| [M-H]- | 549.27052 | 230.1 |
| [M+NH4]+ | 568.31162 | 236.2 |
| [M+K]+ | 589.24096 | 225.8 |
| [M+H-H2O]+ | 533.27506 | 222.0 |
| [M+HCOO]- | 595.27600 | 220.9 |
| [M+CH3COO]- | 609.29165 | 245.0 |
| [M+Na-2H]- | 571.25247 | 220.3 |
| [M]+ | 550.27725 | 220.1 |
| [M]- | 550.27835 | 220.1 |