CID 43140175
2-(2,4-dichlorophenyl)thiazole-4-carboxylic acid
Structural Information
- Molecular Formula
- C10H5Cl2NO2S
- SMILES
- C1=CC(=C(C=C1Cl)Cl)C2=NC(=CS2)C(=O)O
- InChI
- InChI=1S/C10H5Cl2NO2S/c11-5-1-2-6(7(12)3-5)9-13-8(4-16-9)10(14)15/h1-4H,(H,14,15)
- InChIKey
- BAMRISRVXZTIMQ-UHFFFAOYSA-N
- Compound name
- 2-(2,4-dichlorophenyl)-1,3-thiazole-4-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 273.94908 | 152.4 |
| [M+Na]+ | 295.93102 | 164.1 |
| [M-H]- | 271.93452 | 157.5 |
| [M+NH4]+ | 290.97562 | 170.8 |
| [M+K]+ | 311.90496 | 157.9 |
| [M+H-H2O]+ | 255.93906 | 148.0 |
| [M+HCOO]- | 317.94000 | 161.0 |
| [M+CH3COO]- | 331.95565 | 165.3 |
| [M+Na-2H]- | 293.91647 | 152.2 |
| [M]+ | 272.94125 | 157.6 |
| [M]- | 272.94235 | 157.6 |