CID 4262759
2-(3-methoxyphenyl)piperidine
Structural Information
- Molecular Formula
- C12H17NO
- SMILES
- COC1=CC=CC(=C1)C2CCCCN2
- InChI
- InChI=1S/C12H17NO/c1-14-11-6-4-5-10(9-11)12-7-2-3-8-13-12/h4-6,9,12-13H,2-3,7-8H2,1H3
- InChIKey
- ZGWPCADYBFMCJT-UHFFFAOYSA-N
- Compound name
- 2-(3-methoxyphenyl)piperidine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 192.13829 | 143.5 |
| [M+Na]+ | 214.12023 | 148.3 |
| [M-H]- | 190.12373 | 146.5 |
| [M+NH4]+ | 209.16483 | 160.6 |
| [M+K]+ | 230.09417 | 145.0 |
| [M+H-H2O]+ | 174.12827 | 135.9 |
| [M+HCOO]- | 236.12921 | 161.6 |
| [M+CH3COO]- | 250.14486 | 180.2 |
| [M+Na-2H]- | 212.10568 | 148.5 |
| [M]+ | 191.13046 | 138.0 |
| [M]- | 191.13156 | 138.0 |