CID 418309
3-{[(3,4-dichlorophenyl)methyl]amino}propan-1-ol hydrochloride
Structural Information
- Molecular Formula
- C10H13Cl2NO
- SMILES
- C1=CC(=C(C=C1CNCCCO)Cl)Cl
- InChI
- InChI=1S/C10H13Cl2NO/c11-9-3-2-8(6-10(9)12)7-13-4-1-5-14/h2-3,6,13-14H,1,4-5,7H2
- InChIKey
- WIKFFALWKXCIRI-UHFFFAOYSA-N
- Compound name
- 3-[(3,4-dichlorophenyl)methylamino]propan-1-ol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 234.04469 | 148.0 |
| [M+Na]+ | 256.02663 | 156.7 |
| [M-H]- | 232.03013 | 149.6 |
| [M+NH4]+ | 251.07123 | 166.7 |
| [M+K]+ | 272.00057 | 150.6 |
| [M+H-H2O]+ | 216.03467 | 144.1 |
| [M+HCOO]- | 278.03561 | 162.3 |
| [M+CH3COO]- | 292.05126 | 189.3 |
| [M+Na-2H]- | 254.01208 | 152.7 |
| [M]+ | 233.03686 | 150.9 |
| [M]- | 233.03796 | 150.9 |