CID 3934542
19293-60-8
Structural Information
- Molecular Formula
- C10H12N2
- SMILES
- CN1C=C(C2=CC=CC=C21)CN
- InChI
- InChI=1S/C10H12N2/c1-12-7-8(6-11)9-4-2-3-5-10(9)12/h2-5,7H,6,11H2,1H3
- InChIKey
- NOFZMDGMQKRLIV-UHFFFAOYSA-N
- Compound name
- (1-methylindol-3-yl)methanamine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 161.10733 | 131.7 |
| [M+Na]+ | 183.08927 | 142.3 |
| [M-H]- | 159.09277 | 135.4 |
| [M+NH4]+ | 178.13387 | 154.3 |
| [M+K]+ | 199.06321 | 138.7 |
| [M+H-H2O]+ | 143.09731 | 125.6 |
| [M+HCOO]- | 205.09825 | 157.3 |
| [M+CH3COO]- | 219.11390 | 146.4 |
| [M+Na-2H]- | 181.07472 | 139.1 |
| [M]+ | 160.09950 | 132.6 |
| [M]- | 160.10060 | 132.6 |