CID 3898924
(2-methyloxetan-2-yl)methanol
Structural Information
- Molecular Formula
- C5H10O2
- SMILES
- CC1(CCO1)CO
- InChI
- InChI=1S/C5H10O2/c1-5(4-6)2-3-7-5/h6H,2-4H2,1H3
- InChIKey
- SHSBMPDSSWZEPU-UHFFFAOYSA-N
- Compound name
- (2-methyloxetan-2-yl)methanol
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 103.07536 | 115.1 |
| [M+Na]+ | 125.05730 | 121.5 |
| [M-H]- | 101.06080 | 118.5 |
| [M+NH4]+ | 120.10190 | 131.9 |
| [M+K]+ | 141.03124 | 125.5 |
| [M+H-H2O]+ | 85.065340 | 107.2 |
| [M+HCOO]- | 147.06628 | 135.7 |
| [M+CH3COO]- | 161.08193 | 166.8 |
| [M+Na-2H]- | 123.04275 | 124.4 |
| [M]+ | 102.06753 | 123.7 |
| [M]- | 102.06863 | 123.7 |