CID 3871137
4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-amine
Structural Information
- Molecular Formula
- C10H17N3S
- SMILES
- CC1CCCN(C1)CC2=CSC(=N2)N
- InChI
- InChI=1S/C10H17N3S/c1-8-3-2-4-13(5-8)6-9-7-14-10(11)12-9/h7-8H,2-6H2,1H3,(H2,11,12)
- InChIKey
- FIQGFRSJRWEWCC-UHFFFAOYSA-N
- Compound name
- 4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 212.12160 | 146.7 |
| [M+Na]+ | 234.10354 | 153.7 |
| [M-H]- | 210.10704 | 150.2 |
| [M+NH4]+ | 229.14814 | 164.9 |
| [M+K]+ | 250.07748 | 150.2 |
| [M+H-H2O]+ | 194.11158 | 139.2 |
| [M+HCOO]- | 256.11252 | 161.8 |
| [M+CH3COO]- | 270.12817 | 158.3 |
| [M+Na-2H]- | 232.08899 | 146.2 |
| [M]+ | 211.11377 | 143.6 |
| [M]- | 211.11487 | 143.6 |