CID 3827
Ketotifen
Structural Information
- Molecular Formula
- C19H19NOS
- SMILES
- CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1
- InChI
- InChI=1S/C19H19NOS/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19/h2-5,8,11H,6-7,9-10,12H2,1H3
- InChIKey
- ZCVMWBYGMWKGHF-UHFFFAOYSA-N
- Compound name
- 2-(1-methylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 310.12602 | 175.0 |
| [M+Na]+ | 332.10796 | 181.4 |
| [M-H]- | 308.11146 | 182.7 |
| [M+NH4]+ | 327.15256 | 191.9 |
| [M+K]+ | 348.08190 | 178.5 |
| [M+H-H2O]+ | 292.11600 | 169.2 |
| [M+HCOO]- | 354.11694 | 186.5 |
| [M+CH3COO]- | 368.13259 | 184.9 |
| [M+Na-2H]- | 330.09341 | 173.6 |
| [M]+ | 309.11819 | 170.1 |
| [M]- | 309.11929 | 170.1 |