CID 357115
            
    2-azidoadamantane
Structural Information
- Molecular Formula
- C10H15N3
- SMILES
- C1C2CC3CC1CC(C2)C3N=[N+]=[N-]
- InChI
- InChI=1S/C10H15N3/c11-13-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2
- InChIKey
- DBMHNOXGUUDEPE-UHFFFAOYSA-N
- Compound name
- 2-azidoadamantane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) | 
|---|---|---|
| [M+H]+ | 178.13388 | 128.2 | 
| [M+Na]+ | 200.11582 | 129.4 | 
| [M-H]- | 176.11932 | 126.2 | 
| [M+NH4]+ | 195.16042 | 153.1 | 
| [M+K]+ | 216.08976 | 123.7 | 
| [M+H-H2O]+ | 160.12386 | 126.5 | 
| [M+HCOO]- | 222.12480 | 143.2 | 
| [M+CH3COO]- | 236.14045 | 193.6 | 
| [M+Na-2H]- | 198.10127 | 143.2 | 
| [M]+ | 177.12605 | 125.4 | 
| [M]- | 177.12715 | 125.4 |