CID 3374
Flumequine
Structural Information
- Molecular Formula
- C14H12FNO3
- SMILES
- CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2)F)C(=O)O
- InChI
- InChI=1S/C14H12FNO3/c1-7-2-3-8-4-9(15)5-10-12(8)16(7)6-11(13(10)17)14(18)19/h4-7H,2-3H2,1H3,(H,18,19)
- InChIKey
- DPSPPJIUMHPXMA-UHFFFAOYSA-N
- Compound name
- 7-fluoro-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 262.08738 | 154.9 |
| [M+Na]+ | 284.06932 | 165.0 |
| [M-H]- | 260.07282 | 156.3 |
| [M+NH4]+ | 279.11392 | 172.5 |
| [M+K]+ | 300.04326 | 160.6 |
| [M+H-H2O]+ | 244.07736 | 147.2 |
| [M+HCOO]- | 306.07830 | 170.5 |
| [M+CH3COO]- | 320.09395 | 197.8 |
| [M+Na-2H]- | 282.05477 | 159.5 |
| [M]+ | 261.07955 | 154.9 |
| [M]- | 261.08065 | 154.9 |