CID 33529
2-(3,3-dimethylcyclohexylidene)acetaldehyde
Structural Information
- Molecular Formula
- C10H16O
- SMILES
- CC1(CCCC(=CC=O)C1)C
- InChI
- InChI=1S/C10H16O/c1-10(2)6-3-4-9(8-10)5-7-11/h5,7H,3-4,6,8H2,1-2H3
- InChIKey
- TYHKWUGMKWVPDI-UHFFFAOYSA-N
- Compound name
- 2-(3,3-dimethylcyclohexylidene)acetaldehyde
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 153.12740 | 133.1 |
| [M+Na]+ | 175.10934 | 139.5 |
| [M-H]- | 151.11284 | 136.4 |
| [M+NH4]+ | 170.15394 | 156.4 |
| [M+K]+ | 191.08328 | 137.8 |
| [M+H-H2O]+ | 135.11738 | 128.7 |
| [M+HCOO]- | 197.11832 | 153.7 |
| [M+CH3COO]- | 211.13397 | 175.7 |
| [M+Na-2H]- | 173.09479 | 138.4 |
| [M]+ | 152.11957 | 129.7 |
| [M]- | 152.12067 | 129.7 |