CID 33451
2,5-dimethyl-1-hexene
Structural Information
- Molecular Formula
- C8H16
- SMILES
- CC(C)CCC(=C)C
- InChI
- InChI=1S/C8H16/c1-7(2)5-6-8(3)4/h8H,1,5-6H2,2-4H3
- InChIKey
- ISZWTVCVSJVEOL-UHFFFAOYSA-N
- Compound name
- 2,5-dimethylhex-1-ene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 113.13248 | 126.4 |
| [M+Na]+ | 135.11442 | 132.7 |
| [M-H]- | 111.11792 | 126.7 |
| [M+NH4]+ | 130.15902 | 149.4 |
| [M+K]+ | 151.08836 | 132.5 |
| [M+H-H2O]+ | 95.122460 | 122.3 |
| [M+HCOO]- | 157.12340 | 147.8 |
| [M+CH3COO]- | 171.13905 | 174.2 |
| [M+Na-2H]- | 133.09987 | 130.2 |
| [M]+ | 112.12465 | 126.5 |
| [M]- | 112.12575 | 126.5 |