CID 320056
2-methoxy-2-phenylacetonitrile
Structural Information
- Molecular Formula
- C9H9NO
- SMILES
- COC(C#N)C1=CC=CC=C1
- InChI
- InChI=1S/C9H9NO/c1-11-9(7-10)8-5-3-2-4-6-8/h2-6,9H,1H3
- InChIKey
- HYXJXCNHNYUWAZ-UHFFFAOYSA-N
- Compound name
- 2-methoxy-2-phenylacetonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 148.07570 | 131.2 |
| [M+Na]+ | 170.05764 | 140.7 |
| [M-H]- | 146.06114 | 134.5 |
| [M+NH4]+ | 165.10224 | 150.3 |
| [M+K]+ | 186.03158 | 138.3 |
| [M+H-H2O]+ | 130.06568 | 119.1 |
| [M+HCOO]- | 192.06662 | 151.5 |
| [M+CH3COO]- | 206.08227 | 188.3 |
| [M+Na-2H]- | 168.04309 | 137.8 |
| [M]+ | 147.06787 | 126.8 |
| [M]- | 147.06897 | 126.8 |