CID 3159683
2-(1-methylpiperidin-2-yl)acetic acid hydrochloride
Structural Information
- Molecular Formula
- C8H15NO2
- SMILES
- CN1CCCCC1CC(=O)O
- InChI
- InChI=1S/C8H15NO2/c1-9-5-3-2-4-7(9)6-8(10)11/h7H,2-6H2,1H3,(H,10,11)
- InChIKey
- IGBQBRPEHILFLU-UHFFFAOYSA-N
- Compound name
- 2-(1-methylpiperidin-2-yl)acetic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 158.11756 | 135.0 |
| [M+Na]+ | 180.09950 | 140.3 |
| [M-H]- | 156.10300 | 135.2 |
| [M+NH4]+ | 175.14410 | 153.8 |
| [M+K]+ | 196.07344 | 139.2 |
| [M+H-H2O]+ | 140.10754 | 129.1 |
| [M+HCOO]- | 202.10848 | 152.4 |
| [M+CH3COO]- | 216.12413 | 174.5 |
| [M+Na-2H]- | 178.08495 | 138.4 |
| [M]+ | 157.10973 | 130.8 |
| [M]- | 157.11083 | 130.8 |