CID 315748
2-chloro-1-(2-chloro-10h-phenothiazin-10-yl)ethan-1-one
Structural Information
- Molecular Formula
- C14H9Cl2NOS
- SMILES
- C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)Cl)C(=O)CCl
- InChI
- InChI=1S/C14H9Cl2NOS/c15-8-14(18)17-10-3-1-2-4-12(10)19-13-6-5-9(16)7-11(13)17/h1-7H,8H2
- InChIKey
- FXCKKLUGQMWBDD-UHFFFAOYSA-N
- Compound name
- 2-chloro-1-(2-chlorophenothiazin-10-yl)ethanone
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 309.98546 | 159.8 |
| [M+Na]+ | 331.96740 | 170.7 |
| [M-H]- | 307.97090 | 163.4 |
| [M+NH4]+ | 327.01200 | 177.6 |
| [M+K]+ | 347.94134 | 163.8 |
| [M+H-H2O]+ | 291.97544 | 154.7 |
| [M+HCOO]- | 353.97638 | 164.5 |
| [M+CH3COO]- | 367.99203 | 171.3 |
| [M+Na-2H]- | 329.95285 | 164.0 |
| [M]+ | 308.97763 | 165.0 |
| [M]- | 308.97873 | 165.0 |