CID 3155
Dothiepin
Structural Information
- Molecular Formula
- C19H21NS
- SMILES
- CN(C)CCC=C1C2=CC=CC=C2CSC3=CC=CC=C31
- InChI
- InChI=1S/C19H21NS/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3
- InChIKey
- PHTUQLWOUWZIMZ-UHFFFAOYSA-N
- Compound name
- 3-(6H-benzo[c][1]benzothiepin-11-ylidene)-N,N-dimethylpropan-1-amine
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 296.14675 | 168.4 |
| [M+Na]+ | 318.12869 | 173.4 |
| [M-H]- | 294.13219 | 175.3 |
| [M+NH4]+ | 313.17329 | 185.8 |
| [M+K]+ | 334.10263 | 172.5 |
| [M+H-H2O]+ | 278.13673 | 163.1 |
| [M+HCOO]- | 340.13767 | 183.9 |
| [M+CH3COO]- | 354.15332 | 178.9 |
| [M+Na-2H]- | 316.11414 | 171.8 |
| [M]+ | 295.13892 | 167.5 |
| [M]- | 295.14002 | 167.5 |