CID 3124342
3a,4,5,9b-tetrahydro-3h-cyclopenta[c]quinoline-4-carboxylic acid
Structural Information
- Molecular Formula
- C13H13NO2
- SMILES
- C1C=CC2C1C(NC3=CC=CC=C23)C(=O)O
- InChI
- InChI=1S/C13H13NO2/c15-13(16)12-10-6-3-5-8(10)9-4-1-2-7-11(9)14-12/h1-5,7-8,10,12,14H,6H2,(H,15,16)
- InChIKey
- WRJCENKZISEXPF-UHFFFAOYSA-N
- Compound name
- 3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 216.10192 | 146.5 |
| [M+Na]+ | 238.08386 | 153.7 |
| [M-H]- | 214.08736 | 147.7 |
| [M+NH4]+ | 233.12846 | 166.1 |
| [M+K]+ | 254.05780 | 148.9 |
| [M+H-H2O]+ | 198.09190 | 140.5 |
| [M+HCOO]- | 260.09284 | 162.5 |
| [M+CH3COO]- | 274.10849 | 157.9 |
| [M+Na-2H]- | 236.06931 | 150.6 |
| [M]+ | 215.09409 | 142.4 |
| [M]- | 215.09519 | 142.4 |