CID 30945
3-methyl-2(5h)-furanone
Structural Information
- Molecular Formula
- C5H6O2
- SMILES
- CC1=CCOC1=O
- InChI
- InChI=1S/C5H6O2/c1-4-2-3-7-5(4)6/h2H,3H2,1H3
- InChIKey
- VGHBEMPMIVEGJP-UHFFFAOYSA-N
- Compound name
- 4-methyl-2H-furan-5-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 99.044056 | 113.4 |
| [M+Na]+ | 121.02600 | 122.7 |
| [M-H]- | 97.029504 | 118.2 |
| [M+NH4]+ | 116.07060 | 137.4 |
| [M+K]+ | 136.99994 | 123.6 |
| [M+H-H2O]+ | 81.034040 | 109.3 |
| [M+HCOO]- | 143.03498 | 138.3 |
| [M+CH3COO]- | 157.05063 | 163.8 |
| [M+Na-2H]- | 119.01145 | 121.0 |
| [M]+ | 98.036231 | 114.3 |
| [M]- | 98.037329 | 114.3 |