CID 3086228
Levonorgestrel butyrate
Structural Information
- Molecular Formula
- C25H34O3
- SMILES
- CCCC(=O)O[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@H]34)CC)C#C
- InChI
- InChI=1S/C25H34O3/c1-4-7-23(27)28-25(6-3)15-13-22-21-10-8-17-16-18(26)9-11-19(17)20(21)12-14-24(22,25)5-2/h3,16,19-22H,4-5,7-15H2,1-2H3/t19-,20+,21+,22-,24-,25-/m0/s1
- InChIKey
- GPKLGCALNRZIDS-AYEDEZQKSA-N
- Compound name
- [(8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-3-oxo-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] butanoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 383.25808 | 197.9 |
| [M+Na]+ | 405.24002 | 206.6 |
| [M-H]- | 381.24352 | 200.3 |
| [M+NH4]+ | 400.28462 | 216.3 |
| [M+K]+ | 421.21396 | 193.3 |
| [M+H-H2O]+ | 365.24806 | 186.1 |
| [M+HCOO]- | 427.24900 | 202.6 |
| [M+CH3COO]- | 441.26465 | 225.3 |
| [M+Na-2H]- | 403.22547 | 195.0 |
| [M]+ | 382.25025 | 189.0 |
| [M]- | 382.25135 | 189.0 |