CID 30859
Chlorthiophos
Structural Information
- Molecular Formula
- C11H15Cl2O3PS2
- SMILES
- CCOP(=S)(OCC)OC1=CC(=C(C=C1Cl)SC)Cl
- InChI
- InChI=1S/C11H15Cl2O3PS2/c1-4-14-17(18,15-5-2)16-10-6-9(13)11(19-3)7-8(10)12/h6-7H,4-5H2,1-3H3
- InChIKey
- JAZJVWLGNLCNDD-UHFFFAOYSA-N
- Compound name
- (2,5-dichloro-4-methylsulfanylphenoxy)-diethoxy-sulfanylidene-lambda5-phosphane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 360.96501 | 164.7 |
| [M+Na]+ | 382.94695 | 173.8 |
| [M-H]- | 358.95045 | 167.8 |
| [M+NH4]+ | 377.99155 | 180.8 |
| [M+K]+ | 398.92089 | 167.8 |
| [M+H-H2O]+ | 342.95499 | 158.6 |
| [M+HCOO]- | 404.95593 | 173.5 |
| [M+CH3COO]- | 418.97158 | 209.4 |
| [M+Na-2H]- | 380.93240 | 162.4 |
| [M]+ | 359.95718 | 175.5 |
| [M]- | 359.95828 | 175.5 |