CID 30773
Cyanazine
Structural Information
- Molecular Formula
- C9H13ClN6
- SMILES
- CCNC1=NC(=NC(=N1)Cl)NC(C)(C)C#N
- InChI
- InChI=1S/C9H13ClN6/c1-4-12-7-13-6(10)14-8(15-7)16-9(2,3)5-11/h4H2,1-3H3,(H2,12,13,14,15,16)
- InChIKey
- MZZBPDKVEFVLFF-UHFFFAOYSA-N
- Compound name
- 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 241.09630 | 154.2 |
| [M+Na]+ | 263.07824 | 163.2 |
| [M-H]- | 239.08174 | 152.8 |
| [M+NH4]+ | 258.12284 | 166.3 |
| [M+K]+ | 279.05218 | 160.1 |
| [M+H-H2O]+ | 223.08628 | 139.3 |
| [M+HCOO]- | 285.08722 | 166.9 |
| [M+CH3COO]- | 299.10287 | 207.6 |
| [M+Na-2H]- | 261.06369 | 160.6 |
| [M]+ | 240.08847 | 150.1 |
| [M]- | 240.08957 | 150.1 |