CID 3071100
Hydrocinnamonitrile, p-chloro-beta-methyl-
Structural Information
- Molecular Formula
- C10H10ClN
- SMILES
- CC(CC#N)C1=CC=C(C=C1)Cl
- InChI
- InChI=1S/C10H10ClN/c1-8(6-7-12)9-2-4-10(11)5-3-9/h2-5,8H,6H2,1H3
- InChIKey
- VHMBYIQGEOYEDY-UHFFFAOYSA-N
- Compound name
- 3-(4-chlorophenyl)butanenitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 180.05745 | 138.0 |
| [M+Na]+ | 202.03939 | 148.9 |
| [M-H]- | 178.04289 | 141.3 |
| [M+NH4]+ | 197.08399 | 157.1 |
| [M+K]+ | 218.01333 | 143.8 |
| [M+H-H2O]+ | 162.04743 | 127.0 |
| [M+HCOO]- | 224.04837 | 153.7 |
| [M+CH3COO]- | 238.06402 | 193.7 |
| [M+Na-2H]- | 200.02484 | 143.0 |
| [M]+ | 179.04962 | 134.8 |
| [M]- | 179.05072 | 134.8 |