CID 3071008
1h-benzimidazole, 1-(2-ethoxyethyl)-2-(1-piperazinyl)-, (e)-2-butenedioate (2:3)
Structural Information
- Molecular Formula
- C15H22N4O
- SMILES
- CCOCCN1C2=CC=CC=C2N=C1N3CCNCC3
- InChI
- InChI=1S/C15H22N4O/c1-2-20-12-11-19-14-6-4-3-5-13(14)17-15(19)18-9-7-16-8-10-18/h3-6,16H,2,7-12H2,1H3
- InChIKey
- BGYDYFZTTYHHAL-UHFFFAOYSA-N
- Compound name
- 1-(2-ethoxyethyl)-2-piperazin-1-ylbenzimidazole
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 275.18663 | 165.9 |
| [M+Na]+ | 297.16857 | 172.7 |
| [M-H]- | 273.17207 | 166.1 |
| [M+NH4]+ | 292.21317 | 178.6 |
| [M+K]+ | 313.14251 | 167.3 |
| [M+H-H2O]+ | 257.17661 | 155.4 |
| [M+HCOO]- | 319.17755 | 180.9 |
| [M+CH3COO]- | 333.19320 | 175.2 |
| [M+Na-2H]- | 295.15402 | 169.4 |
| [M]+ | 274.17880 | 164.3 |
| [M]- | 274.17990 | 164.3 |