CID 3062670
Methanone, 1h-indol-3-yl(2-methoxyphenyl)-
Structural Information
- Molecular Formula
- C16H13NO2
- SMILES
- COC1=CC=CC=C1C(=O)C2=CNC3=CC=CC=C32
- InChI
- InChI=1S/C16H13NO2/c1-19-15-9-5-3-7-12(15)16(18)13-10-17-14-8-4-2-6-11(13)14/h2-10,17H,1H3
- InChIKey
- PTRREJCKNUCEBY-UHFFFAOYSA-N
- Compound name
- 1H-indol-3-yl-(2-methoxyphenyl)methanone
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 252.10192 | 155.4 |
| [M+Na]+ | 274.08386 | 164.8 |
| [M-H]- | 250.08736 | 161.2 |
| [M+NH4]+ | 269.12846 | 173.3 |
| [M+K]+ | 290.05780 | 159.7 |
| [M+H-H2O]+ | 234.09190 | 147.9 |
| [M+HCOO]- | 296.09284 | 178.0 |
| [M+CH3COO]- | 310.10849 | 168.2 |
| [M+Na-2H]- | 272.06931 | 160.7 |
| [M]+ | 251.09409 | 157.1 |
| [M]- | 251.09519 | 157.1 |