CID 3010606
(2r,3s,5r)-5-(2,6-diaminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)tetrahydrofuran-2-carbonitrile
Structural Information
- Molecular Formula
- C11H13N7O3
- SMILES
- C1[C@@H]([C@](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)(CO)C#N)O
- InChI
- InChI=1S/C11H13N7O3/c12-2-11(3-19)5(20)1-6(21-11)18-4-15-7-8(13)16-10(14)17-9(7)18/h4-6,19-20H,1,3H2,(H4,13,14,16,17)/t5-,6+,11+/m0/s1
- InChIKey
- UAXOQYIVDJZULU-WGDKSQQYSA-N
- Compound name
- (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 292.11528 | 159.6 |
| [M+Na]+ | 314.09722 | 170.9 |
| [M-H]- | 290.10072 | 159.0 |
| [M+NH4]+ | 309.14182 | 170.8 |
| [M+K]+ | 330.07116 | 166.5 |
| [M+H-H2O]+ | 274.10526 | 144.4 |
| [M+HCOO]- | 336.10620 | 173.2 |
| [M+CH3COO]- | 350.12185 | 168.4 |
| [M+Na-2H]- | 312.08267 | 162.0 |
| [M]+ | 291.10745 | 153.5 |
| [M]- | 291.10855 | 153.5 |