CID 300160
1-(pyridin-3-yl)butane-1,3-dione
Structural Information
- Molecular Formula
- C9H9NO2
- SMILES
- CC(=O)CC(=O)C1=CN=CC=C1
- InChI
- InChI=1S/C9H9NO2/c1-7(11)5-9(12)8-3-2-4-10-6-8/h2-4,6H,5H2,1H3
- InChIKey
- OVPXWZQQDUKDFN-UHFFFAOYSA-N
- Compound name
- 1-pyridin-3-ylbutane-1,3-dione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 164.07060 | 132.3 |
| [M+Na]+ | 186.05254 | 139.7 |
| [M-H]- | 162.05604 | 134.6 |
| [M+NH4]+ | 181.09714 | 151.3 |
| [M+K]+ | 202.02648 | 138.5 |
| [M+H-H2O]+ | 146.06058 | 125.8 |
| [M+HCOO]- | 208.06152 | 154.5 |
| [M+CH3COO]- | 222.07717 | 177.9 |
| [M+Na-2H]- | 184.03799 | 138.2 |
| [M]+ | 163.06277 | 132.9 |
| [M]- | 163.06387 | 132.9 |