CID 3000846
Bromo-methyl-(3-methylbut-2-enyl)[?]thione
Structural Information
- Molecular Formula
- C16H20BrN3S
- SMILES
- C[C@H]1CN2C3=C(C=CC(=C3CN1CC=C(C)C)Br)NC2=S
- InChI
- InChI=1S/C16H20BrN3S/c1-10(2)6-7-19-9-12-13(17)4-5-14-15(12)20(8-11(19)3)16(21)18-14/h4-6,11H,7-9H2,1-3H3,(H,18,21)/t11-/m0/s1
- InChIKey
- KLGCHFDLQQTTNC-NSHDSACASA-N
- Compound name
- (11S)-7-bromo-11-methyl-10-(3-methylbut-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4(13),5,7-triene-2-thione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 366.06340 | 170.3 |
| [M+Na]+ | 388.04534 | 182.9 |
| [M-H]- | 364.04884 | 174.8 |
| [M+NH4]+ | 383.08994 | 187.2 |
| [M+K]+ | 404.01928 | 172.5 |
| [M+H-H2O]+ | 348.05338 | 170.0 |
| [M+HCOO]- | 410.05432 | 179.2 |
| [M+CH3COO]- | 424.06997 | 182.1 |
| [M+Na-2H]- | 386.03079 | 171.4 |
| [M]+ | 365.05557 | 188.0 |
| [M]- | 365.05667 | 188.0 |