CID 3000781
R86154
Structural Information
- Molecular Formula
- C15H18ClN3S
- SMILES
- C[C@H]1CN(CC2=C3N1C(=S)NC3=CC(=C2)Cl)CC(=C)C
- InChI
- InChI=1S/C15H18ClN3S/c1-9(2)6-18-7-10(3)19-14-11(8-18)4-12(16)5-13(14)17-15(19)20/h4-5,10H,1,6-8H2,2-3H3,(H,17,20)/t10-/m0/s1
- InChIKey
- IHQQZXISEYPLLJ-JTQLQIEISA-N
- Compound name
- (12S)-6-chloro-12-methyl-10-(2-methylprop-2-enyl)-1,3,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene-2-thione
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 308.09828 | 170.0 |
| [M+Na]+ | 330.08022 | 181.2 |
| [M-H]- | 306.08372 | 171.7 |
| [M+NH4]+ | 325.12482 | 186.1 |
| [M+K]+ | 346.05416 | 177.4 |
| [M+H-H2O]+ | 290.08826 | 163.2 |
| [M+HCOO]- | 352.08920 | 176.2 |
| [M+CH3COO]- | 366.10485 | 180.3 |
| [M+Na-2H]- | 328.06567 | 169.1 |
| [M]+ | 307.09045 | 171.5 |
| [M]- | 307.09155 | 171.5 |