CID 298720
Triphenylphosphine selenide
Structural Information
- Molecular Formula
- C18H15PSe
- SMILES
- C1=CC=C(C=C1)P(=[Se])(C2=CC=CC=C2)C3=CC=CC=C3
- InChI
- InChI=1S/C18H15PSe/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
- InChIKey
- ZFVJLNKVUKIPPI-UHFFFAOYSA-N
- Compound name
- triphenyl(selanylidene)-lambda5-phosphane
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 343.01494 | 179.3 |
| [M+Na]+ | 364.99688 | 184.6 |
| [M-H]- | 341.00038 | 186.5 |
| [M+NH4]+ | 360.04148 | 194.1 |
| [M+K]+ | 380.97082 | 178.2 |
| [M+H-H2O]+ | 325.00492 | 167.6 |
| [M+HCOO]- | 387.00586 | 205.8 |
| [M+CH3COO]- | 401.02151 | 202.0 |
| [M+Na-2H]- | 362.98233 | 181.7 |
| [M]+ | 342.00711 | 176.8 |
| [M]- | 342.00821 | 176.8 |