CID 294989
1-(4-chlorophenyl)-3-(4-fluorophenyl)urea
Structural Information
- Molecular Formula
- C13H10ClFN2O
- SMILES
- C1=CC(=CC=C1NC(=O)NC2=CC=C(C=C2)Cl)F
- InChI
- InChI=1S/C13H10ClFN2O/c14-9-1-5-11(6-2-9)16-13(18)17-12-7-3-10(15)4-8-12/h1-8H,(H2,16,17,18)
- InChIKey
- MMAPXNAETQDQNW-UHFFFAOYSA-N
- Compound name
- 1-(4-chlorophenyl)-3-(4-fluorophenyl)urea
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 265.05385 | 155.4 |
| [M+Na]+ | 287.03579 | 163.7 |
| [M-H]- | 263.03929 | 161.0 |
| [M+NH4]+ | 282.08039 | 172.3 |
| [M+K]+ | 303.00973 | 158.0 |
| [M+H-H2O]+ | 247.04383 | 147.8 |
| [M+HCOO]- | 309.04477 | 176.1 |
| [M+CH3COO]- | 323.06042 | 198.3 |
| [M+Na-2H]- | 285.02124 | 161.0 |
| [M]+ | 264.04602 | 154.8 |
| [M]- | 264.04712 | 154.8 |