CID 2795575
4385-77-7
Structural Information
- Molecular Formula
- C12H9NO2
- SMILES
- C1=CC(=CC(=C1)C(=O)O)C2=CN=CC=C2
- InChI
- InChI=1S/C12H9NO2/c14-12(15)10-4-1-3-9(7-10)11-5-2-6-13-8-11/h1-8H,(H,14,15)
- InChIKey
- PXASTGBSGPFLFJ-UHFFFAOYSA-N
- Compound name
- 3-pyridin-3-ylbenzoic acid
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 200.07060 | 140.9 |
| [M+Na]+ | 222.05254 | 148.9 |
| [M-H]- | 198.05604 | 145.3 |
| [M+NH4]+ | 217.09714 | 157.7 |
| [M+K]+ | 238.02648 | 145.3 |
| [M+H-H2O]+ | 182.06058 | 133.4 |
| [M+HCOO]- | 244.06152 | 162.8 |
| [M+CH3COO]- | 258.07717 | 181.3 |
| [M+Na-2H]- | 220.03799 | 147.8 |
| [M]+ | 199.06277 | 139.9 |
| [M]- | 199.06387 | 139.9 |