CID 2773439
Ethyl 3-amino-1h-pyrrole-2-carboxylate
Structural Information
- Molecular Formula
- C7H10N2O2
- SMILES
- CCOC(=O)C1=C(C=CN1)N
- InChI
- InChI=1S/C7H10N2O2/c1-2-11-7(10)6-5(8)3-4-9-6/h3-4,9H,2,8H2,1H3
- InChIKey
- SPNDLEQTZLQLTA-UHFFFAOYSA-N
- Compound name
- ethyl 3-amino-1H-pyrrole-2-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 155.08151 | 131.6 |
| [M+Na]+ | 177.06345 | 139.3 |
| [M-H]- | 153.06695 | 132.4 |
| [M+NH4]+ | 172.10805 | 151.9 |
| [M+K]+ | 193.03739 | 137.6 |
| [M+H-H2O]+ | 137.07149 | 125.4 |
| [M+HCOO]- | 199.07243 | 154.8 |
| [M+CH3COO]- | 213.08808 | 174.0 |
| [M+Na-2H]- | 175.04890 | 135.3 |
| [M]+ | 154.07368 | 130.1 |
| [M]- | 154.07478 | 130.1 |