CID 2742167
Methyl 1,2,5-trimethyl-1h-pyrrole-3-carboxylate
Structural Information
- Molecular Formula
- C9H13NO2
- SMILES
- CC1=CC(=C(N1C)C)C(=O)OC
- InChI
- InChI=1S/C9H13NO2/c1-6-5-8(9(11)12-4)7(2)10(6)3/h5H,1-4H3
- InChIKey
- VRUCCWQGKPXNMI-UHFFFAOYSA-N
- Compound name
- methyl 1,2,5-trimethylpyrrole-3-carboxylate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 168.10192 | 133.7 |
| [M+Na]+ | 190.08386 | 143.9 |
| [M-H]- | 166.08736 | 137.0 |
| [M+NH4]+ | 185.12846 | 155.6 |
| [M+K]+ | 206.05780 | 143.1 |
| [M+H-H2O]+ | 150.09190 | 128.3 |
| [M+HCOO]- | 212.09284 | 157.4 |
| [M+CH3COO]- | 226.10849 | 180.8 |
| [M+Na-2H]- | 188.06931 | 136.4 |
| [M]+ | 167.09409 | 137.5 |
| [M]- | 167.09519 | 137.5 |