CID 2733406
1-bromo-2-chloro-4-fluorobenzene
Structural Information
- Molecular Formula
- C6H3BrClF
- SMILES
- C1=CC(=C(C=C1F)Cl)Br
- InChI
- InChI=1S/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H
- InChIKey
- LEFQPBAWVJEIJS-UHFFFAOYSA-N
- Compound name
- 1-bromo-2-chloro-4-fluorobenzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 208.91635 | 128.3 |
| [M+Na]+ | 230.89829 | 143.1 |
| [M-H]- | 206.90179 | 134.1 |
| [M+NH4]+ | 225.94289 | 152.2 |
| [M+K]+ | 246.87223 | 130.4 |
| [M+H-H2O]+ | 190.90633 | 129.6 |
| [M+HCOO]- | 252.90727 | 146.0 |
| [M+CH3COO]- | 266.92292 | 181.9 |
| [M+Na-2H]- | 228.88374 | 136.9 |
| [M]+ | 207.90852 | 147.2 |
| [M]- | 207.90962 | 147.2 |