CID 259577
Hellebrigenin
Structural Information
- Molecular Formula
- C24H32O6
- SMILES
- C[C@]12CC[C@H]3[C@H]([C@]1(CC[C@@H]2C4=COC(=O)C=C4)O)CC[C@]5([C@@]3(CC[C@@H](C5)O)C=O)O
- InChI
- InChI=1S/C24H32O6/c1-21-8-5-18-19(6-10-23(28)12-16(26)4-9-22(18,23)14-25)24(21,29)11-7-17(21)15-2-3-20(27)30-13-15/h2-3,13-14,16-19,26,28-29H,4-12H2,1H3/t16-,17+,18-,19+,21+,22-,23-,24-/m0/s1
- InChIKey
- TVKPTWJPKVSGJB-XHCIOXAKSA-N
- Compound name
- (3S,5S,8R,9S,10S,13R,14S,17R)-3,5,14-trihydroxy-13-methyl-17-(6-oxopyran-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 417.22716 | 198.7 |
| [M+Na]+ | 439.20910 | 204.8 |
| [M-H]- | 415.21260 | 203.1 |
| [M+NH4]+ | 434.25370 | 217.7 |
| [M+K]+ | 455.18304 | 200.1 |
| [M+H-H2O]+ | 399.21714 | 191.4 |
| [M+HCOO]- | 461.21808 | 203.2 |
| [M+CH3COO]- | 475.23373 | 205.8 |
| [M+Na-2H]- | 437.19455 | 201.1 |
| [M]+ | 416.21933 | 193.5 |
| [M]- | 416.22043 | 193.5 |