CID 24017
4'-methoxyacrylophenone
Structural Information
- Molecular Formula
- C10H10O2
- SMILES
- COC1=CC=C(C=C1)C(=O)C=C
- InChI
- InChI=1S/C10H10O2/c1-3-10(11)8-4-6-9(12-2)7-5-8/h3-7H,1H2,2H3
- InChIKey
- YMESWDPSFKMFND-UHFFFAOYSA-N
- Compound name
- 1-(4-methoxyphenyl)prop-2-en-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 163.07536 | 131.5 |
| [M+Na]+ | 185.05730 | 139.8 |
| [M-H]- | 161.06080 | 135.5 |
| [M+NH4]+ | 180.10190 | 152.4 |
| [M+K]+ | 201.03124 | 138.0 |
| [M+H-H2O]+ | 145.06534 | 126.0 |
| [M+HCOO]- | 207.06628 | 155.7 |
| [M+CH3COO]- | 221.08193 | 178.6 |
| [M+Na-2H]- | 183.04275 | 137.4 |
| [M]+ | 162.06753 | 133.1 |
| [M]- | 162.06863 | 133.1 |