CID 23128
2,4,5-trichlorotoluene
Structural Information
- Molecular Formula
- C7H5Cl3
- SMILES
- CC1=CC(=C(C=C1Cl)Cl)Cl
- InChI
- InChI=1S/C7H5Cl3/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,1H3
- InChIKey
- ZCXHZKNWIYVQNC-UHFFFAOYSA-N
- Compound name
- 1,2,4-trichloro-5-methylbenzene
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 194.95296 | 131.7 |
| [M+Na]+ | 216.93490 | 143.6 |
| [M-H]- | 192.93840 | 134.2 |
| [M+NH4]+ | 211.97950 | 153.0 |
| [M+K]+ | 232.90884 | 137.9 |
| [M+H-H2O]+ | 176.94294 | 129.4 |
| [M+HCOO]- | 238.94388 | 141.5 |
| [M+CH3COO]- | 252.95953 | 183.3 |
| [M+Na-2H]- | 214.92035 | 136.5 |
| [M]+ | 193.94513 | 134.7 |
| [M]- | 193.94623 | 134.7 |