CID 22672613
248920-09-4
Structural Information
- Molecular Formula
- C9H8BrN
- SMILES
- CC1=C(C(=CC=C1)CC#N)Br
- InChI
- InChI=1S/C9H8BrN/c1-7-3-2-4-8(5-6-11)9(7)10/h2-4H,5H2,1H3
- InChIKey
- LQQGCXTYKIBEJD-UHFFFAOYSA-N
- Compound name
- 2-(2-bromo-3-methylphenyl)acetonitrile
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 209.99129 | 133.1 |
| [M+Na]+ | 231.97323 | 147.5 |
| [M-H]- | 207.97673 | 138.2 |
| [M+NH4]+ | 227.01783 | 153.8 |
| [M+K]+ | 247.94717 | 135.8 |
| [M+H-H2O]+ | 191.98127 | 127.0 |
| [M+HCOO]- | 253.98221 | 154.0 |
| [M+CH3COO]- | 267.99786 | 196.8 |
| [M+Na-2H]- | 229.95868 | 140.7 |
| [M]+ | 208.98346 | 145.6 |
| [M]- | 208.98456 | 145.6 |