CID 219165
Methyl 3-(diethylamino)propanoate
Structural Information
- Molecular Formula
- C8H17NO2
- SMILES
- CCN(CC)CCC(=O)OC
- InChI
- InChI=1S/C8H17NO2/c1-4-9(5-2)7-6-8(10)11-3/h4-7H2,1-3H3
- InChIKey
- MGOYBMFCELTAHS-UHFFFAOYSA-N
- Compound name
- methyl 3-(diethylamino)propanoate
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 160.13321 | 137.2 |
| [M+Na]+ | 182.11515 | 143.1 |
| [M-H]- | 158.11865 | 138.7 |
| [M+NH4]+ | 177.15975 | 158.6 |
| [M+K]+ | 198.08909 | 144.5 |
| [M+H-H2O]+ | 142.12319 | 131.8 |
| [M+HCOO]- | 204.12413 | 161.6 |
| [M+CH3COO]- | 218.13978 | 184.8 |
| [M+Na-2H]- | 180.10060 | 141.5 |
| [M]+ | 159.12538 | 141.2 |
| [M]- | 159.12648 | 141.2 |