CID 21722188
Nothofagin
Structural Information
- Molecular Formula
- C21H24O10
- SMILES
- C1=CC(=CC=C1CCC(=O)C2=C(C=C(C(=C2O)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O
- InChI
- InChI=1S/C21H24O10/c22-8-14-17(27)19(29)20(30)21(31-14)16-13(26)7-12(25)15(18(16)28)11(24)6-3-9-1-4-10(23)5-2-9/h1-2,4-5,7,14,17,19-23,25-30H,3,6,8H2/t14-,17-,19+,20-,21+/m1/s1
- InChIKey
- VZBPTZZTCBNBOZ-VJXVFPJBSA-N
- Compound name
- 3-(4-hydroxyphenyl)-1-[2,4,6-trihydroxy-3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]propan-1-one
- Related CIDs
2D Structure
Profile
Predicted Collision Cross Section
| Adduct | m/z | Predicted CCS (Ų) |
|---|---|---|
| [M+H]+ | 437.14421 | 200.0 |
| [M+Na]+ | 459.12615 | 204.0 |
| [M-H]- | 435.12965 | 200.6 |
| [M+NH4]+ | 454.17075 | 202.7 |
| [M+K]+ | 475.10009 | 202.1 |
| [M+H-H2O]+ | 419.13419 | 191.7 |
| [M+HCOO]- | 481.13513 | 206.4 |
| [M+CH3COO]- | 495.15078 | 219.4 |
| [M+Na-2H]- | 457.11160 | 194.8 |
| [M]+ | 436.13638 | 198.0 |
| [M]- | 436.13748 | 198.0 |